EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO10S3 |
| Net Charge | 0 |
| Average Mass | 437.514 |
| Monoisotopic Mass | 437.04841 |
| SMILES | CS(=O)CCCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO10S3/c1-25(18)5-3-2-4-8(13-23-26(19,20)21)24-12-11(17)10(16)9(15)7(6-14)22-12/h7,9-12,14-17H,2-6H2,1H3,(H,19,20,21)/b13-8-/t7-,9-,10+,11-,12+,25?/m1/s1 |
| InChIKey | GMMLNKINDDUDCF-BYNGITTOSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica oleracea var. italica (ncbitaxon:36774) | - | PubMed (23110644) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucoraphanin (CHEBI:79311) has functional parent glucoerucin (CHEBI:79325) |
| glucoraphanin (CHEBI:79311) is a sulfoxide (CHEBI:22063) |
| glucoraphanin (CHEBI:79311) is a thia-alkylglucosinolic acid (CHEBI:79322) |
| glucoraphanin (CHEBI:79311) is conjugate acid of glucoraphanin(1−) (CHEBI:5415) |
| Incoming Relation(s) |
| glucoraphanin(1−) (CHEBI:5415) is conjugate base of glucoraphanin (CHEBI:79311) |
| IUPAC Name |
|---|
| 1-S-[(1Z)-5-(methylsulfinyl)-N-(sulfooxy)pentanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 4-Methylsulfinylbutyl glucosinolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08419 | KEGG COMPOUND |
| C00007545 | KNApSAcK |
| HMDB0038404 | HMDB |
| Glucoraphanin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8167699 | Reaxys |
| CAS:21414-41-5 | ChemIDplus |
| CAS:21414-41-5 | KEGG COMPOUND |
| Citations |
|---|