EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H46O4 |
| Net Charge | 0 |
| Average Mass | 386.617 |
| Monoisotopic Mass | 386.33961 |
| SMILES | O=C(O)C[C@H](O)CCCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C23H46O4/c24-20-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-22(25)21-23(26)27/h22,24-25H,1-21H2,(H,26,27)/t22-/m1/s1 |
| InChIKey | UEDFAQDOEGWTRL-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3,22-dihydroxytricosanoic acid (CHEBI:79299) has functional parent tricosanoic acid (CHEBI:42394) |
| (3R)-3,22-dihydroxytricosanoic acid (CHEBI:79299) is a (3R)-3-hydroxy fatty acid (CHEBI:85678) |
| (3R)-3,22-dihydroxytricosanoic acid (CHEBI:79299) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (3R)-3,22-dihydroxytricosanoic acid (CHEBI:79299) is a ω-hydroxy-very-long-chain fatty acid (CHEBI:194304) |
| Incoming Relation(s) |
| bhos#42 (CHEBI:79271) has functional parent (3R)-3,22-dihydroxytricosanoic acid (CHEBI:79299) |
| IUPAC Name |
|---|
| (3R)-3,23-dihydroxytricosanoic acid |