EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H56O7 |
| Net Charge | 0 |
| Average Mass | 516.760 |
| Monoisotopic Mass | 516.40260 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCCCCCCC[C@@H](O)CC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C29H56O7/c1-24-26(31)23-27(32)29(36-24)35-21-19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-25(30)22-28(33)34/h24-27,29-32H,2-23H2,1H3,(H,33,34)/t24-,25+,26+,27+,29+/m0/s1 |
| InChIKey | BTMBBRJRFNNJHP-YVESUCRWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), daf-22(ok693), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhos#42 (CHEBI:79271) has functional parent (3R)-3,22-dihydroxytricosanoic acid (CHEBI:79299) |
| bhos#42 (CHEBI:79271) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhos#42 (CHEBI:79271) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhos#42 (CHEBI:79271) is a monocarboxylic acid (CHEBI:25384) |
| bhos#42 (CHEBI:79271) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| IUPAC Name |
|---|
| (3R)-23-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxytricosanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-23-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-tricosanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhos%2342 | SMID |
| Citations |
|---|