EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O4 |
| Net Charge | 0 |
| Average Mass | 344.536 |
| Monoisotopic Mass | 344.29266 |
| SMILES | O=C(O)C[C@H](O)CCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C20H40O4/c21-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-19(22)18-20(23)24/h19,21-22H,1-18H2,(H,23,24)/t19-/m1/s1 |
| InChIKey | HWPIBZBKWABMAW-LJQANCHMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R)-3,20-dihydroxyicosanoic acid (CHEBI:79292) has functional parent 20-hydroxyicosanoic acid (CHEBI:79190) |
| (3R)-3,20-dihydroxyicosanoic acid (CHEBI:79292) is a (3R)-3-hydroxy fatty acid (CHEBI:85678) |
| (3R)-3,20-dihydroxyicosanoic acid (CHEBI:79292) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (3R)-3,20-dihydroxyicosanoic acid (CHEBI:79292) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| bhos#36 (CHEBI:79268) has functional parent (3R)-3,20-dihydroxyicosanoic acid (CHEBI:79292) |
| IUPAC Name |
|---|
| (3R)-3,20-dihydroxyicosanoic acid |
| Synonym | Source |
|---|---|
| (3R)-3,20-dihydroxyeicosanoic acid | ChEBI |