EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40O3 |
| Net Charge | 0 |
| Average Mass | 328.537 |
| Monoisotopic Mass | 328.29775 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C20H40O3/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h21H,1-19H2,(H,22,23) |
| InChIKey | JLDIWYKSFMPIDW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxyicosanoic acid (CHEBI:79190) has functional parent icosanoic acid (CHEBI:28822) |
| 20-hydroxyicosanoic acid (CHEBI:79190) is a straight-chain saturated fatty acid (CHEBI:39418) |
| 20-hydroxyicosanoic acid (CHEBI:79190) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 20-hydroxyicosanoic acid (CHEBI:79190) is conjugate acid of 20-hydroxyicosanoate (CHEBI:140692) |
| Incoming Relation(s) |
| (3R)-3,20-dihydroxyicosanoic acid (CHEBI:79292) has functional parent 20-hydroxyicosanoic acid (CHEBI:79190) |
| oscr#36 (CHEBI:79158) has functional parent 20-hydroxyicosanoic acid (CHEBI:79190) |
| 20-hydroxyicosanoate (CHEBI:140692) is conjugate base of 20-hydroxyicosanoic acid (CHEBI:79190) |
| IUPAC Name |
|---|
| 20-hydroxyicosanoic acid |
| Synonyms | Source |
|---|---|
| ω-hydroxyarachidic acid | ChEBI |
| 20-hydroxyarachidic acid | ChEBI |
| ω-hydroxyicosanoic acid | ChEBI |
| 20-hydroxyeicosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050075 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1794083 | Reaxys |