EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H48O7 |
| Net Charge | 0 |
| Average Mass | 460.652 |
| Monoisotopic Mass | 460.34000 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCCC[C@@H](O)CC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C25H48O7/c1-20-22(27)19-23(28)25(32-20)31-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-21(26)18-24(29)30/h20-23,25-28H,2-19H2,1H3,(H,29,30)/t20-,21+,22+,23+,25+/m0/s1 |
| InChIKey | HRSIKXSIYLWWRZ-BKXWLNCVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8), daf-22(ok693), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhos#34 (CHEBI:79267) has functional parent (3R)-3,19-dihydroxynonadecanoic acid (CHEBI:79291) |
| bhos#34 (CHEBI:79267) has functional parent oscr#34 (CHEBI:79156) |
| bhos#34 (CHEBI:79267) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhos#34 (CHEBI:79267) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhos#34 (CHEBI:79267) is a monocarboxylic acid (CHEBI:25384) |
| bhos#34 (CHEBI:79267) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| bhos#34 (CHEBI:79267) is conjugate acid of bhos#34(1-) (CHEBI:139814) |
| Incoming Relation(s) |
| bhos#34(1-) (CHEBI:139814) is conjugate base of bhos#34 (CHEBI:79267) |
| IUPAC Name |
|---|
| (3R)-19-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxynonadecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-19-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhos%2334 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233512 | Reaxys |
| CAS:1355682-87-9 | SMID |
| Citations |
|---|