EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H48O6 |
| Net Charge | 0 |
| Average Mass | 444.653 |
| Monoisotopic Mass | 444.34509 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C25H48O6/c1-21-22(26)20-23(27)25(31-21)30-19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-24(28)29/h21-23,25-27H,2-20H2,1H3,(H,28,29)/t21-,22+,23+,25+/m0/s1 |
| InChIKey | DUCJPMRHUUCBAA-XJTUCQONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13), daf-22(ok693), acox-1(ok2257) and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#34 (CHEBI:79156) has functional parent 19-hydroxynonadecanoic acid (CHEBI:79179) |
| oscr#34 (CHEBI:79156) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#34 (CHEBI:79156) is a monocarboxylic acid (CHEBI:25384) |
| oscr#34 (CHEBI:79156) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#34 (CHEBI:79156) is conjugate acid of oscr#34(1−) (CHEBI:140038) |
| Incoming Relation(s) |
| bhos#34 (CHEBI:79267) has functional parent oscr#34 (CHEBI:79156) |
| oscr#34-CoA (CHEBI:140039) has functional parent oscr#34 (CHEBI:79156) |
| oscr#34(1−) (CHEBI:140038) is conjugate base of oscr#34 (CHEBI:79156) |
| IUPAC Name |
|---|
| 19-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]nonadecanoic acid |
| Synonym | Source |
|---|---|
| 19-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2334 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233487 | Reaxys |
| CAS:1355682-39-1 | SMID |
| Citations |
|---|