EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44O7 |
| Net Charge | 0 |
| Average Mass | 432.598 |
| Monoisotopic Mass | 432.30870 |
| SMILES | C[C@H](CCCCCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H44O7/c1-17(29-23-21(26)16-20(25)18(2)30-23)13-11-9-7-5-3-4-6-8-10-12-14-19(24)15-22(27)28/h17-21,23-26H,3-16H2,1-2H3,(H,27,28)/t17-,18+,19-,20-,21-,23-/m1/s1 |
| InChIKey | MUVQYJIVDRBMJO-XBTHPWMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms. It is a major ascaroside in dhs-28(hj8) and maoc-1(hj13) mutant worms and has been detected in daf-22(ok693) and acox-1(ok2257) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#30 (CHEBI:79235) has functional parent (3R,16R)-3,16-dihydroxymargaric acid (CHEBI:79249) |
| bhas#30 (CHEBI:79235) has functional parent ascr#30 (CHEBI:78968) |
| bhas#30 (CHEBI:79235) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#30 (CHEBI:79235) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#30 (CHEBI:79235) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#30 (CHEBI:79235) is a monocarboxylic acid (CHEBI:25384) |
| bhas#30 (CHEBI:79235) is conjugate acid of bhas#30(1-) (CHEBI:139753) |
| Incoming Relation(s) |
| ibha#30 (CHEBI:79360) has functional parent bhas#30 (CHEBI:79235) |
| bhas#30(1-) (CHEBI:139753) is conjugate base of bhas#30 (CHEBI:79235) |
| IUPAC Name |
|---|
| (3R,16R)-16-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxyheptadecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-16R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-heptadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2330%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233484 | Reaxys |
| CAS:1355682-63-1 | SMID |
| Citations |
|---|