EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44O6 |
| Net Charge | 0 |
| Average Mass | 416.599 |
| Monoisotopic Mass | 416.31379 |
| SMILES | C[C@H](CCCCCCCCCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H44O6/c1-18(28-23-21(25)17-20(24)19(2)29-23)15-13-11-9-7-5-3-4-6-8-10-12-14-16-22(26)27/h18-21,23-25H,3-17H2,1-2H3,(H,26,27)/t18-,19+,20-,21-,23-/m1/s1 |
| InChIKey | XIVYAVYHUZLGIV-AIDNLNPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms and acox-1(ok2257), dhs-28(hj8), and maoc-1(hj13) mutant worms. Ascr#30 is a major ascaroside in daf-22(ok693) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#30 (CHEBI:78968) has functional parent (16R)-16-hydroxymargaric acid (CHEBI:79001) |
| ascr#30 (CHEBI:78968) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#30 (CHEBI:78968) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#30 (CHEBI:78968) is a monocarboxylic acid (CHEBI:25384) |
| ascr#30 (CHEBI:78968) is conjugate acid of ascr#30(1-) (CHEBI:139678) |
| Incoming Relation(s) |
| bhas#30 (CHEBI:79235) has functional parent ascr#30 (CHEBI:78968) |
| ascr#30(1-) (CHEBI:139678) is conjugate base of ascr#30 (CHEBI:78968) |
| IUPAC Name |
|---|
| (16R)-16-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptadecanoic acid |
| Synonym | Source |
|---|---|
| 16R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-heptadecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2330%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233460 | Reaxys |
| CAS:1355681-75-2 | SMID |
| Citations |
|---|