EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O7 |
| Net Charge | 0 |
| Average Mass | 390.517 |
| Monoisotopic Mass | 390.26175 |
| SMILES | C[C@H](CCCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H38O7/c1-14(26-20-18(23)13-17(22)15(2)27-20)10-8-6-4-3-5-7-9-11-16(21)12-19(24)25/h14-18,20-23H,3-13H2,1-2H3,(H,24,25)/t14-,15+,16-,17-,18-,20-/m1/s1 |
| InChIKey | UXIWWNCPRZIUAB-XGZVRMHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#24 (CHEBI:79232) has functional parent (3R,13R)-3,13-dihydroxymyristic acid (CHEBI:79245) |
| bhas#24 (CHEBI:79232) has functional parent ascr#24 (CHEBI:78962) |
| bhas#24 (CHEBI:79232) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#24 (CHEBI:79232) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#24 (CHEBI:79232) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#24 (CHEBI:79232) is a monocarboxylic acid (CHEBI:25384) |
| bhas#24 (CHEBI:79232) is conjugate acid of bhas#24(1-) (CHEBI:139744) |
| Incoming Relation(s) |
| ibha#24 (CHEBI:79357) has functional parent bhas#24 (CHEBI:79232) |
| bhas#24(1-) (CHEBI:139744) is conjugate base of bhas#24 (CHEBI:79232) |
| IUPAC Name |
|---|
| (3R,13R)-13-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxytetradecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-13R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-tetradecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2324%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233450 | Reaxys |
| CAS:1355682-56-2 | SMID |
| Citations |
|---|