EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O6 |
| Net Charge | 0 |
| Average Mass | 374.518 |
| Monoisotopic Mass | 374.26684 |
| SMILES | C[C@H](CCCCCCCCCCCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H38O6/c1-15(25-20-18(22)14-17(21)16(2)26-20)12-10-8-6-4-3-5-7-9-11-13-19(23)24/h15-18,20-22H,3-14H2,1-2H3,(H,23,24)/t15-,16+,17-,18-,20-/m1/s1 |
| InChIKey | NRXYKCLIMLPUIO-KWXDATOUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in daf-22(ok693), dhs-28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#24 (CHEBI:78962) has functional parent (13R)-13-hydroxymyristic acid (CHEBI:78989) |
| ascr#24 (CHEBI:78962) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#24 (CHEBI:78962) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#24 (CHEBI:78962) is a monocarboxylic acid (CHEBI:25384) |
| ascr#24 (CHEBI:78962) is conjugate acid of ascr#24(1-) (CHEBI:139659) |
| Incoming Relation(s) |
| bhas#24 (CHEBI:79232) has functional parent ascr#24 (CHEBI:78962) |
| glas#24 (CHEBI:79306) has functional parent ascr#24 (CHEBI:78962) |
| ascr#24(1-) (CHEBI:139659) is conjugate base of ascr#24 (CHEBI:78962) |
| IUPAC Name |
|---|
| (13R)-13-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]tetradecanoic acid |
| Synonym | Source |
|---|---|
| 13R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-tetradecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2324%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233431 | Reaxys |
| CAS:1355681-61-6 | SMID |
| Citations |
|---|