EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O7 |
| Net Charge | 0 |
| Average Mass | 376.490 |
| Monoisotopic Mass | 376.24610 |
| SMILES | C[C@H](CCCCCCCC[C@@H](O)CC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H36O7/c1-13(25-19-17(22)12-16(21)14(2)26-19)9-7-5-3-4-6-8-10-15(20)11-18(23)24/h13-17,19-22H,3-12H2,1-2H3,(H,23,24)/t13-,14+,15-,16-,17-,19-/m1/s1 |
| InChIKey | ARJGFPSUJRWUSF-CQQDWVGSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) and maoc-1(hj13) and acox-1(ok2257) mutant worms. It is a major ascaroside in dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#22 (CHEBI:79231) has functional parent (3R,12R)-3,12-dihydroxytridecanoic acid (CHEBI:79244) |
| bhas#22 (CHEBI:79231) has functional parent ascr#22 (CHEBI:78960) |
| bhas#22 (CHEBI:79231) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| bhas#22 (CHEBI:79231) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| bhas#22 (CHEBI:79231) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| bhas#22 (CHEBI:79231) is a monocarboxylic acid (CHEBI:25384) |
| bhas#22 (CHEBI:79231) is conjugate acid of bhas#22(1-) (CHEBI:139741) |
| Incoming Relation(s) |
| ibha#22 (CHEBI:79356) has functional parent bhas#22 (CHEBI:79231) |
| bhas#22(1-) (CHEBI:139741) is conjugate base of bhas#22 (CHEBI:79231) |
| IUPAC Name |
|---|
| (3R,12R)-12-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-3-hydroxytridecanoic acid |
| Synonym | Source |
|---|---|
| 3R-hydroxy-12R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-tridecanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| bhas%2322%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233432 | Reaxys |
| CAS:1355681-17-2 | SMID |
| Citations |
|---|