EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H35O7 |
| Net Charge | -1 |
| Average Mass | 375.482 |
| Monoisotopic Mass | 375.23883 |
| SMILES | C[C@H](CCCCCCCC[C@@H](O)CC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H36O7/c1-13(25-19-17(22)12-16(21)14(2)26-19)9-7-5-3-4-6-8-10-15(20)11-18(23)24/h13-17,19-22H,3-12H2,1-2H3,(H,23,24)/p-1/t13-,14+,15-,16-,17-,19-/m1/s1 |
| InChIKey | ARJGFPSUJRWUSF-CQQDWVGSSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bhas#22(1-) (CHEBI:139741) is a organic molecular entity (CHEBI:50860) |
| bhas#22(1-) (CHEBI:139741) is conjugate base of bhas#22 (CHEBI:79231) |
| Incoming Relation(s) |
| bhas#22 (CHEBI:79231) is conjugate acid of bhas#22(1-) (CHEBI:139741) |