EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40O3 |
| Net Charge | 0 |
| Average Mass | 340.548 |
| Monoisotopic Mass | 340.29775 |
| SMILES | O=C(O)/C=C/CCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C21H40O3/c22-20-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19-21(23)24/h17,19,22H,1-16,18,20H2,(H,23,24)/b19-17+ |
| InChIKey | CKLPOWVYEZATJE-HTXNQAPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-21-hydroxyhenicos-2-enoic acid (CHEBI:79194) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-21-hydroxyhenicos-2-enoic acid (CHEBI:79194) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-21-hydroxyhenicos-2-enoic acid (CHEBI:79194) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-21-hydroxyhenicos-2-enoic acid (CHEBI:79194) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| Incoming Relation(s) |
| oscr#37 (CHEBI:79159) has functional parent (2E)-21-hydroxyhenicos-2-enoic acid (CHEBI:79194) |
| IUPAC Name |
|---|
| (2E)-21-hydroxyhenicos-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2E)-21-hydroxyheneicos-2-enoic acid | ChEBI |
| (2E)-ω-hydroxyheneicos-2-enoic acid | ChEBI |
| (2E)-ω-hydroxyhenicos-2-enoic acid | ChEBI |