EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O3 |
| Net Charge | 0 |
| Average Mass | 300.483 |
| Monoisotopic Mass | 300.26645 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C18H36O3/c19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(20)21/h19H,1-17H2,(H,20,21) |
| InChIKey | VLHZUYUOEGBBJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxyoctadecanoic acid (CHEBI:79182) has role apoptosis inducer (CHEBI:68495) |
| 18-hydroxyoctadecanoic acid (CHEBI:79182) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 18-hydroxyoctadecanoic acid (CHEBI:79182) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 18-hydroxyoctadecanoic acid (CHEBI:79182) is conjugate acid of 18-hydroxyoctadecanoate (CHEBI:86046) |
| Incoming Relation(s) |
| oscr#32 (CHEBI:79154) has functional parent 18-hydroxyoctadecanoic acid (CHEBI:79182) |
| 18-hydroxyoctadecanoate (CHEBI:86046) is conjugate base of 18-hydroxyoctadecanoic acid (CHEBI:79182) |
| IUPAC Name |
|---|
| 18-hydroxyoctadecanoic acid |
| Synonyms | Source |
|---|---|
| 18-hydroxystearic acid | ChEBI |
| ω-hydroxyoctadecanoic acid | ChEBI |
| ω-hydroxystearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000136 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1789809 | Reaxys |
| Reaxys:1791558 | Reaxys |
| Citations |
|---|