EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H46O6 |
| Net Charge | 0 |
| Average Mass | 430.626 |
| Monoisotopic Mass | 430.32944 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCCCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C24H46O6/c1-20-21(25)19-22(26)24(30-20)29-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-23(27)28/h20-22,24-26H,2-19H2,1H3,(H,27,28)/t20-,21+,22+,24+/m0/s1 |
| InChIKey | IBSHVVRARSKTDE-JVNMPXIPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in maoc-1(hj13), daf-22(ok693), and dhs-28(hj8) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#32 (CHEBI:79154) has functional parent 18-hydroxyoctadecanoic acid (CHEBI:79182) |
| oscr#32 (CHEBI:79154) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#32 (CHEBI:79154) is a monocarboxylic acid (CHEBI:25384) |
| oscr#32 (CHEBI:79154) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#32 (CHEBI:79154) is conjugate acid of oscr#32(1−) (CHEBI:140032) |
| Incoming Relation(s) |
| bhos#32 (CHEBI:79266) has functional parent oscr#32 (CHEBI:79154) |
| oscr#32-CoA (CHEBI:140033) has functional parent oscr#32 (CHEBI:79154) |
| oscr#32(1−) (CHEBI:140032) is conjugate base of oscr#32 (CHEBI:79154) |
| IUPAC Name |
|---|
| 18-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]octadecanoic acid |
| Synonyms | Source |
|---|---|
| 18-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-octadecanoic acid | SMID |
| 18-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]stearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| oscr%2332%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233478 | Reaxys |
| CAS:1355682-35-7 | SMID |
| Citations |
|---|