EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10N2O2 |
| Net Charge | 0 |
| Average Mass | 226.235 |
| Monoisotopic Mass | 226.07423 |
| SMILES | O=C(O)c1cccc2c1Nc1ccccc1N2 |
| InChI | InChI=1S/C13H10N2O2/c16-13(17)8-4-3-7-11-12(8)15-10-6-2-1-5-9(10)14-11/h1-7,14-15H,(H,16,17) |
| InChIKey | RWCXEOMFBZOODX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,10-dihydrophenazine-1-carboxylic acid (CHEBI:79181) has role bacterial metabolite (CHEBI:76969) |
| 5,10-dihydrophenazine-1-carboxylic acid (CHEBI:79181) is a aromatic carboxylic acid (CHEBI:33859) |
| 5,10-dihydrophenazine-1-carboxylic acid (CHEBI:79181) is a phenazines (CHEBI:39201) |
| 5,10-dihydrophenazine-1-carboxylic acid (CHEBI:79181) is conjugate acid of 5,10-dihydrophenazine-1-carboxylate (CHEBI:78312) |
| Incoming Relation(s) |
| 5,10-dihydrophenazine-1-carboxylate (CHEBI:78312) is conjugate base of 5,10-dihydrophenazine-1-carboxylic acid (CHEBI:79181) |
| IUPAC Name |
|---|
| 5,10-dihydrophenazine-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-12874 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:86864 | Reaxys |
| Citations |
|---|