EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8O4 |
| Net Charge | -2 |
| Average Mass | 216.192 |
| Monoisotopic Mass | 216.04336 |
| SMILES | [O-]c1ccccc1Oc1cccc(O)c1[O-] |
| InChI | InChI=1S/C12H10O4/c13-8-4-1-2-6-10(8)16-11-7-3-5-9(14)12(11)15/h1-7,13-15H/p-2 |
| InChIKey | XEAZDMSYJLCYDK-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2',3-trihydroxydiphenyl ether(2−) (CHEBI:79174) is a phenolate anion (CHEBI:50525) |
| 2,2',3-trihydroxydiphenyl ether(2−) (CHEBI:79174) is conjugate base of 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) |
| Incoming Relation(s) |
| 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) is conjugate acid of 2,2',3-trihydroxydiphenyl ether(2−) (CHEBI:79174) |
| IUPAC Name |
|---|
| 2-hydroxy-6-(2-oxidophenoxy)phenolate |
| Synonym | Source |
|---|---|
| 2,2',3-trihydroxydiphenyl ether dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,2',3-trihydroxydiphenyl ether | UniProt |