EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O4 |
| Net Charge | 0 |
| Average Mass | 218.208 |
| Monoisotopic Mass | 218.05791 |
| SMILES | Oc1ccccc1Oc1cccc(O)c1O |
| InChI | InChI=1S/C12H10O4/c13-8-4-1-2-6-10(8)16-11-7-3-5-9(14)12(11)15/h1-7,13-15H |
| InChIKey | XEAZDMSYJLCYDK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) has role mouse metabolite (CHEBI:75771) |
| 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) is a aromatic ether (CHEBI:35618) |
| 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) is a catechols (CHEBI:33566) |
| 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) is a phenols (CHEBI:33853) |
| 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) is conjugate acid of 2,2',3-trihydroxydiphenyl ether(2−) (CHEBI:79174) |
| Incoming Relation(s) |
| 2,2',3-trihydroxydiphenyl ether(2−) (CHEBI:79174) is conjugate base of 2,2',3-trihydroxydiphenyl ether (CHEBI:27381) |
| IUPAC Name |
|---|
| 3-(2-hydroxyphenoxy)benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 2,2',3-Trihydroxydiphenylether | KEGG COMPOUND |
| 2,3,2'-trihydroxydiphenyl ether | ChEBI |
| 3-(2-hydroxyphenoxy)catechol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11058912 | Beilstein |
| CAS:128292-53-5 | ChemIDplus |