EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O3 |
| Net Charge | 0 |
| Average Mass | 144.170 |
| Monoisotopic Mass | 144.07864 |
| SMILES | O=C(O)/C=C/CCCCO |
| InChI | InChI=1S/C7H12O3/c8-6-4-2-1-3-5-7(9)10/h3,5,8H,1-2,4,6H2,(H,9,10)/b5-3+ |
| InChIKey | DJIWUWVCLSPORR-HWKANZROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-7-hydroxyhept-2-enoic acid (CHEBI:79161) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E)-7-hydroxyhept-2-enoic acid (CHEBI:79161) is a straight-chain fatty acid (CHEBI:59202) |
| (2E)-7-hydroxyhept-2-enoic acid (CHEBI:79161) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2E)-7-hydroxyhept-2-enoic acid (CHEBI:79161) is a ω-hydroxy-medium-chain fatty acid (CHEBI:194303) |
| Incoming Relation(s) |
| oscr#7 (CHEBI:79132) has functional parent (2E)-7-hydroxyhept-2-enoic acid (CHEBI:79161) |
| Synonym | Source |
|---|---|
| 7-hydroxy-trans-2-heptenoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1904098 | Reaxys |