EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O6 |
| Net Charge | 0 |
| Average Mass | 304.383 |
| Monoisotopic Mass | 304.18859 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O6/c1-11-12(16)10-13(17)15(21-11)20-9-7-5-3-2-4-6-8-14(18)19/h11-13,15-17H,2-10H2,1H3,(H,18,19)/t11-,12+,13+,15+/m0/s1 |
| InChIKey | WGGIJTBDSYSSPD-KYEXWDHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms. A major ascaroside in acox-1(ok2257) mutant worms, oscr#10 has also been detected in dhs-28(hj8) and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#10 (CHEBI:79134) has functional parent 9-hydroxynonanoic acid (CHEBI:79121) |
| oscr#10 (CHEBI:79134) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| oscr#10 (CHEBI:79134) is a monocarboxylic acid (CHEBI:25384) |
| oscr#10 (CHEBI:79134) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| oscr#10 (CHEBI:79134) is conjugate acid of oscr#10(1−) (CHEBI:139965) |
| Incoming Relation(s) |
| bhos#10 (CHEBI:79256) has functional parent oscr#10 (CHEBI:79134) |
| icos#10 (CHEBI:79117) has functional parent oscr#10 (CHEBI:79134) |
| oscr#10-CoA (CHEBI:139966) has functional parent oscr#10 (CHEBI:79134) |
| oscr#10(1−) (CHEBI:139965) is conjugate base of oscr#10 (CHEBI:79134) |
| IUPAC Name |
|---|
| 9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]nonanoic acid |
| Synonym | Source |
|---|---|
| 9-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-nonanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| oscr%2310 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233398 | Reaxys |
| CAS:1355681-22-9 | SMID |
| Citations |
|---|