EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H27O6 |
| Net Charge | -1 |
| Average Mass | 303.375 |
| Monoisotopic Mass | 303.18131 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCCCC(=O)[O-])[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C15H28O6/c1-11-12(16)10-13(17)15(21-11)20-9-7-5-3-2-4-6-8-14(18)19/h11-13,15-17H,2-10H2,1H3,(H,18,19)/p-1/t11-,12+,13+,15+/m0/s1 |
| InChIKey | WGGIJTBDSYSSPD-KYEXWDHISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oscr#10(1−) (CHEBI:139965) is a hydroxy fatty acid ascaroside anion (CHEBI:140307) |
| oscr#10(1−) (CHEBI:139965) is conjugate base of oscr#10 (CHEBI:79134) |
| Incoming Relation(s) |
| oscr#10 (CHEBI:79134) is conjugate acid of oscr#10(1−) (CHEBI:139965) |
| IUPAC Name |
|---|
| 9-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]nonanoate |