EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O4 |
| Net Charge | 0 |
| Average Mass | 218.208 |
| Monoisotopic Mass | 218.05791 |
| SMILES | Cc1cc(O)cc2c(C(=O)O)c(O)ccc12 |
| InChI | InChI=1S/C12H10O4/c1-6-4-7(13)5-9-8(6)2-3-10(14)11(9)12(15)16/h2-5,13-14H,1H3,(H,15,16) |
| InChIKey | BLBGRTHACSTGEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,7-dihydroxy-5-methyl-1-naphthoic acid (CHEBI:79122) has role bacterial metabolite (CHEBI:76969) |
| 2,7-dihydroxy-5-methyl-1-naphthoic acid (CHEBI:79122) is a naphthalenediols (CHEBI:23783) |
| 2,7-dihydroxy-5-methyl-1-naphthoic acid (CHEBI:79122) is a naphthoic acid (CHEBI:25483) |
| 2,7-dihydroxy-5-methyl-1-naphthoic acid (CHEBI:79122) is conjugate acid of 2,7-dihydroxy-5-methyl-1-naphthoate (CHEBI:78281) |
| Incoming Relation(s) |
| 2,7-dihydroxy-5-methyl-1-naphthoate (CHEBI:78281) is conjugate base of 2,7-dihydroxy-5-methyl-1-naphthoic acid (CHEBI:79122) |
| IUPAC Name |
|---|
| 2,7-dihydroxy-5-methyl-1-naphthoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-16518 | MetaCyc |
| Citations |
|---|