EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9O4 |
| Net Charge | -1 |
| Average Mass | 217.200 |
| Monoisotopic Mass | 217.05063 |
| SMILES | Cc1cc(O)cc2c(C(=O)[O-])c(O)ccc12 |
| InChI | InChI=1S/C12H10O4/c1-6-4-7(13)5-9-8(6)2-3-10(14)11(9)12(15)16/h2-5,13-14H,1H3,(H,15,16)/p-1 |
| InChIKey | BLBGRTHACSTGEL-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,7-dihydroxy-5-methyl-1-naphthoate (CHEBI:78281) has role bacterial metabolite (CHEBI:76969) |
| 2,7-dihydroxy-5-methyl-1-naphthoate (CHEBI:78281) is a naphthoate (CHEBI:25482) |
| 2,7-dihydroxy-5-methyl-1-naphthoate (CHEBI:78281) is conjugate base of 2,7-dihydroxy-5-methyl-1-naphthoic acid (CHEBI:79122) |
| Incoming Relation(s) |
| 2,7-dihydroxy-5-methyl-1-naphthoic acid (CHEBI:79122) is conjugate acid of 2,7-dihydroxy-5-methyl-1-naphthoate (CHEBI:78281) |
| IUPAC Name |
|---|
| 2,7-dihydroxy-5-methyl-1-naphthoate |
| UniProt Name | Source |
|---|---|
| 2,7-dihydroxy-5-methyl-1-naphthoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16518 | MetaCyc |
| Citations |
|---|