EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:79112 - 7-hydroxyheptanoic acid
| Formula | C7H14O3 |
| Net Charge | 0 |
| Average Mass | 146.186 |
| Monoisotopic Mass | 146.09429 |
| SMILES | O=C(O)CCCCCCO |
| InChI | InChI=1S/C7H14O3/c8-6-4-2-1-3-5-7(9)10/h8H,1-6H2,(H,9,10) |
| InChIKey | PNAJBOZYCFSQDJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-hydroxyheptanoic acid (CHEBI:79112) has functional parent heptanoic acid (CHEBI:45571) |
| 7-hydroxyheptanoic acid (CHEBI:79112) is a straight-chain fatty acid (CHEBI:59202) |
| 7-hydroxyheptanoic acid (CHEBI:79112) is a ω-hydroxy-medium-chain fatty acid (CHEBI:194303) |
| Incoming Relation(s) |
| 1-palmitoyl-2-(7-hydroxyheptanoyl)-sn-glycero-3-phosphocholine (CHEBI:142748) has functional parent 7-hydroxyheptanoic acid (CHEBI:79112) |
| icos#1 (CHEBI:79111) has functional parent 7-hydroxyheptanoic acid (CHEBI:79112) |
| oscr#1 (CHEBI:79130) has functional parent 7-hydroxyheptanoic acid (CHEBI:79112) |
| IUPAC Name |
|---|
| 7-hydroxyheptanoic acid |
| Synonyms | Source |
|---|---|
| ω-hydroxyheptanoic acid | ChEBI |
| ω-hydroxy enanthoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050019 | LIPID MAPS |
| Citations |
|---|