EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29NO7 |
| Net Charge | 0 |
| Average Mass | 419.474 |
| Monoisotopic Mass | 419.19440 |
| SMILES | C[C@@H]1O[C@@H](OCCCCCCC(=O)O)[C@H](O)C[C@H]1OC(=O)c1cnc2ccccc12 |
| InChI | InChI=1S/C22H29NO7/c1-14-19(30-21(27)16-13-23-17-9-6-5-8-15(16)17)12-18(24)22(29-14)28-11-7-3-2-4-10-20(25)26/h5-6,8-9,13-14,18-19,22-24H,2-4,7,10-12H2,1H3,(H,25,26)/t14-,18+,19+,22+/m0/s1 |
| InChIKey | JPMANLDTTFCEPQ-XYHOUYMGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in wild type (N2) worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icos#1 (CHEBI:79111) has functional parent 7-hydroxyheptanoic acid (CHEBI:79112) |
| icos#1 (CHEBI:79111) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| icos#1 (CHEBI:79111) is a 4-O-(1H-indol-3-ylcarbonyl)ascaroside (CHEBI:79024) |
| icos#1 (CHEBI:79111) is a monocarboxylic acid (CHEBI:25384) |
| icos#1 (CHEBI:79111) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| IUPAC Name |
|---|
| 7-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}heptanoic acid |
| Synonym | Source |
|---|---|
| 7-(3'R-hydroxy-5'R-O-(1H-indol-3-ylcarbonyl)-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-heptanoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| icos%231%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233440 | Reaxys |
| CAS:1355681-32-1 | SMID |
| Citations |
|---|