EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O3 |
| Net Charge | 0 |
| Average Mass | 148.162 |
| Monoisotopic Mass | 148.08479 |
| SMILES | N[C@@H](CCCNO)C(=O)O |
| InChI | InChI=1S/C5H12N2O3/c6-4(5(8)9)2-1-3-7-10/h4,7,10H,1-3,6H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | OZMJDTPATROLQC-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-hydroxy-L-ornithine (CHEBI:79095) is a L-ornithine derivative (CHEBI:21368) |
| N5-hydroxy-L-ornithine (CHEBI:79095) is a hydroxylamines (CHEBI:24709) |
| N5-hydroxy-L-ornithine (CHEBI:79095) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| N5-hydroxy-L-ornithine (CHEBI:79095) is tautomer of N5-hydroxy-L-ornithine zwitterion (CHEBI:78275) |
| Incoming Relation(s) |
| N5-hydroxy-L-ornithine zwitterion (CHEBI:78275) is tautomer of N5-hydroxy-L-ornithine (CHEBI:79095) |
| IUPAC Name |
|---|
| N5-hydroxy-L-ornithine |
| Synonyms | Source |
|---|---|
| N5-hydroxyornithine | ChEBI |
| delta-N-Hydroxyornithine | ChemIDplus |
| omega-N-Hydroxyornithine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2243109 | Reaxys |
| CAS:35187-58-7 | ChemIDplus |