EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O3 |
| Net Charge | 0 |
| Average Mass | 148.162 |
| Monoisotopic Mass | 148.08479 |
| SMILES | [NH3+][C@@H](CCCNO)C(=O)[O-] |
| InChI | InChI=1S/C5H12N2O3/c6-4(5(8)9)2-1-3-7-10/h4,7,10H,1-3,6H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | OZMJDTPATROLQC-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-hydroxy-L-ornithine zwitterion (CHEBI:78275) is a amino-acid zwitterion (CHEBI:35238) |
| N5-hydroxy-L-ornithine zwitterion (CHEBI:78275) is tautomer of N5-hydroxy-L-ornithine (CHEBI:79095) |
| Incoming Relation(s) |
| N5-hydroxy-L-ornithine (CHEBI:79095) is tautomer of N5-hydroxy-L-ornithine zwitterion (CHEBI:78275) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-(hydroxyamino)pentanoate |
| UniProt Name | Source |
|---|---|
| N5-hydroxy-L-ornithine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-11571 | MetaCyc |
| Citations |
|---|