EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O2 |
| Net Charge | 0 |
| Average Mass | 186.210 |
| Monoisotopic Mass | 186.06808 |
| SMILES | Cc1cccc2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C12H10O2/c1-8-4-2-6-10-9(8)5-3-7-11(10)12(13)14/h2-7H,1H3,(H,13,14) |
| InChIKey | VLEZTIKHFUAVRK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseofuscus (ncbitaxon:146922) | - | PubMed (20485749) | |
| Streptomyces sahachiroi (ncbitaxon:285525) | - | PubMed (20485749) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-1-naphthoic acid (CHEBI:79082) has role bacterial metabolite (CHEBI:76969) |
| 5-methyl-1-naphthoic acid (CHEBI:79082) is a naphthoic acid (CHEBI:25483) |
| 5-methyl-1-naphthoic acid (CHEBI:79082) is conjugate acid of 5-methyl-1-naphthoate (CHEBI:78251) |
| Incoming Relation(s) |
| 5-methyl-1-naphthoate (CHEBI:78251) is conjugate base of 5-methyl-1-naphthoic acid (CHEBI:79082) |
| IUPAC Name |
|---|
| 5-methyl-1-naphthoic acid |
| Synonym | Source |
|---|---|
| 5-methylnaphthalene-1-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-16514 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2362059 | Reaxys |
| Citations |
|---|