EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H9O2 |
| Net Charge | -1 |
| Average Mass | 185.202 |
| Monoisotopic Mass | 185.06080 |
| SMILES | Cc1cccc2c(C(=O)[O-])cccc12 |
| InChI | InChI=1S/C12H10O2/c1-8-4-2-6-10-9(8)5-3-7-11(10)12(13)14/h2-7H,1H3,(H,13,14)/p-1 |
| InChIKey | VLEZTIKHFUAVRK-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces griseofuscus (ncbitaxon:146922) | - | PubMed (20485749) | |
| Streptomyces sahachiroi (ncbitaxon:285525) | - | PubMed (20485749) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-1-naphthoate (CHEBI:78251) has role bacterial metabolite (CHEBI:76969) |
| 5-methyl-1-naphthoate (CHEBI:78251) is a naphthoate (CHEBI:25482) |
| 5-methyl-1-naphthoate (CHEBI:78251) is conjugate base of 5-methyl-1-naphthoic acid (CHEBI:79082) |
| Incoming Relation(s) |
| 5-methyl-1-naphthoic acid (CHEBI:79082) is conjugate acid of 5-methyl-1-naphthoate (CHEBI:78251) |
| IUPAC Name |
|---|
| 5-methyl-1-naphthoate |
| Synonym | Source |
|---|---|
| 5-methylnaphthalene-1-carboxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-methyl-1-naphthoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16514 | MetaCyc |
| Citations |
|---|