EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2Br.C35H60N2O4 |
| Net Charge | 0 |
| Average Mass | 732.683 |
| Monoisotopic Mass | 730.29198 |
| SMILES | [Br-].[Br-].[H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])C[C@H]([N+]3(C)CCCCC3)[C@]4([H])OC(C)=O)[C@@]1(C)C[C@H]([N+]1(C)CCCCC1)[C@@H](OC(C)=O)C2 |
| InChI | InChI=1S/C35H60N2O4.2BrH/c1-24(38)40-32-21-26-13-14-27-28(35(26,4)23-31(32)37(6)19-11-8-12-20-37)15-16-34(3)29(27)22-30(33(34)41-25(2)39)36(5)17-9-7-10-18-36;;/h26-33H,7-23H2,1-6H3;2*1H/q+2;;/p-2/t26-,27+,28-,29-,30-,31-,32-,33-,34-,35-;;/m0../s1 |
| InChIKey | NPIJXCQZLFKBMV-YTGGZNJNSA-L |
| Roles Classification |
|---|
| Biological Roles: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pancuronium bromide (CHEBI:7908) has part pancuronium (CHEBI:7907) |
| pancuronium bromide (CHEBI:7908) has role cholinergic antagonist (CHEBI:48873) |
| pancuronium bromide (CHEBI:7908) has role muscle relaxant (CHEBI:51371) |
| pancuronium bromide (CHEBI:7908) has role nicotinic antagonist (CHEBI:48878) |
| pancuronium bromide (CHEBI:7908) is a bromide salt (CHEBI:22925) |
| IUPAC Name |
|---|
| 3α,17β-diacetoxy-2β,16β-bis(1-methylpiperidinium-1-yl)-5α-androstane dibromide |
| INNs | Source |
|---|---|
| bromure de pancuronium | ChemIDplus |
| bromuro de pancuronio | ChemIDplus |
| pancuronii bromidum | ChemIDplus |
| pancuronium bromide | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2β,16β-dipiperidino-5α-androstane-3α,17β-diol diacetate dimethobromide | ChemIDplus |
| (2β,3α,5α,16β,17β)-3,17-bis(acetyloxy)-2,16-bis(1-methylpiperidinium-1-yl)androstane dibromide | IUPAC |
| 3α,17β-diacetoxy-2β,16β-dipiperidino-5α-androstane dimethobromide | ChemIDplus |
| Brand Names | Source |
|---|---|
| Mioblock | DrugBank |
| Pavulon | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4226892 | Reaxys |
| CAS:15500-66-0 | KEGG DRUG |
| CAS:15500-66-0 | ChemIDplus |