EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H64O24 |
| Net Charge | 0 |
| Average Mass | 976.972 |
| Monoisotopic Mass | 976.37875 |
| SMILES | CC(/C=C/C=C(\C)C(=O)O[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)=C\C=C\C=C(C)\C=C\C=C(/C)C(=O)O[C@@H]1O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C44H64O24/c1-19(11-7-13-21(3)39(59)67-43-37(57)33(53)29(49)25(65-43)17-61-41-35(55)31(51)27(47)23(15-45)63-41)9-5-6-10-20(2)12-8-14-22(4)40(60)68-44-38(58)34(54)30(50)26(66-44)18-62-42-36(56)32(52)28(48)24(16-46)64-42/h5-14,23-38,41-58H,15-18H2,1-4H3/b6-5+,11-7+,12-8+,19-9+,20-10+,21-13+,22-14+/t23-,24-,25-,26-,27-,28-,29-,30-,31+,32+,33+,34+,35-,36-,37-,38-,41-,42-,43+,44+/m1/s1 |
| InChIKey | SEBIKDIMAPSUBY-RTJKDTQDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crocus sativus (ncbitaxon:82528) | - | DOI (10.1002/hlca.19270100148) | From stigmata, PO:0009073 |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Applications: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crocin-1 (CHEBI:79068) has functional parent gentiobiose (CHEBI:28066) |
| crocin-1 (CHEBI:79068) has functional parent β-D-gentiobiosyl crocetin (CHEBI:62769) |
| crocin-1 (CHEBI:79068) has role antioxidant (CHEBI:22586) |
| crocin-1 (CHEBI:79068) has role food colouring (CHEBI:77182) |
| crocin-1 (CHEBI:79068) has role histological dye (CHEBI:77178) |
| crocin-1 (CHEBI:79068) has role plant metabolite (CHEBI:76924) |
| crocin-1 (CHEBI:79068) is a diester (CHEBI:51307) |
| crocin-1 (CHEBI:79068) is a disaccharide derivative (CHEBI:63353) |
| crocin-1 (CHEBI:79068) is a diterpenoid (CHEBI:23849) |
| IUPAC Name |
|---|
| bis[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-({[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}methyl)tetrahydro-2H-pyran-2-yl] (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioate |
| Synonyms | Source |
|---|---|
| alpha-crocin | KNApSAcK |
| C.I. 75100 | ChEBI |
| crocetin di-gentiobiose ester | ChEBI |
| crocetin digentiobioside | KNApSAcK |
| crocetin di-β-D-gentiobiose ester | ChEBI |
| crocine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| bis(β-D-gentiobiosyl) crocetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003769 | KNApSAcK |
| C08589 | KEGG COMPOUND |
| CPD-8666 | MetaCyc |
| Crocin | Wikipedia |
| HMDB0002398 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78445 | Reaxys |
| CAS:39465-00-4 | ChemIDplus |
| CAS:42553-65-1 | KEGG COMPOUND |
| Citations |
|---|