EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@@H](OC[C@H]2OC(O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1x_1-5][a2122h-1b_1-5]/1-2/a6-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11?,12-/m1/s1 |
| InChIKey | DLRVVLDZNNYCBX-CQUJWQHSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crocus sativus (ncbitaxon:82528) | stigma (BTO:0001303) | PubMed (24338885) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentiobiose (CHEBI:28066) has role plant metabolite (CHEBI:76924) |
| gentiobiose (CHEBI:28066) is a glycosylglucose (CHEBI:24405) |
| Incoming Relation(s) |
| crocin-1 (CHEBI:79068) has functional parent gentiobiose (CHEBI:28066) |
| kaempferol 3-β-gentiobioside (CHEBI:136785) has functional parent gentiobiose (CHEBI:28066) |
| quercetin 3-β-gentiobioside (CHEBI:136778) has functional parent gentiobiose (CHEBI:28066) |
| α-D-Glcp-(1→6)-β-D-Glcp-(1→6)-D-Glcp (CHEBI:148308) has functional parent gentiobiose (CHEBI:28066) |
| β-D-gentiobiosyl crocetin (CHEBI:62769) has functional parent gentiobiose (CHEBI:28066) |
| β-D-Glcp-(1→2)-[β-D-Glcp-(1→6)]-D-Glcp (CHEBI:147943) has functional parent gentiobiose (CHEBI:28066) |
| β-D-Glcp-(1→3)-[β-D-Glcp-(1→6)]-D-Glcp (CHEBI:147977) has functional parent gentiobiose (CHEBI:28066) |
| alpha-Gentiobiose (CHEBI:183828) is a gentiobiose (CHEBI:28066) |
| β-D-Glcp-(1→6)-β-D-Glcp (CHEBI:71422) is a gentiobiose (CHEBI:28066) |
| IUPAC Name |
|---|
| β-D-glucopyranosyl-(1→6)-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 6-O-β-D-glucopyranosyl-D-glucopyranose | IUPAC |
| 6-O-β-D-glucopyranosyl-D-glucose | JCBN |
| Gentiobiose | KEGG COMPOUND |
| D-Glc(β1→6)D-Glc | ChEBI |
| β-D-Glc-(1→6)-D-Glc | JCBN |
| β-D-Glcp-(1→6)-D-Glcp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08240 | KEGG COMPOUND |
| Gentiobiose | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4875396 | Reaxys |
| CAS:554-91-6 | KEGG COMPOUND |
| CAS:554-91-6 | ChemIDplus |
| Citations |
|---|