EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | CC(C)COC(=O)c1ccccc1C(=O)OCC(C)C |
| InChI | InChI=1S/C16H22O4/c1-11(2)9-19-15(17)13-7-5-6-8-14(13)16(18)20-10-12(3)4/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | MGWAVDBGNNKXQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | PPAR modulator Any compound which acts on the peroxisome proliferator-activated receptor. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Applications: | plasticiser Any compound that is used as an additive to increase the plasticity or fluidity of a substance, particularly but not exclusively to synthetic polymers. endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diisobutyl phthalate (CHEBI:79053) has functional parent isobutanol (CHEBI:46645) |
| diisobutyl phthalate (CHEBI:79053) has role plasticiser (CHEBI:79056) |
| diisobutyl phthalate (CHEBI:79053) has role PPAR modulator (CHEBI:70781) |
| diisobutyl phthalate (CHEBI:79053) has role teratogenic agent (CHEBI:50905) |
| diisobutyl phthalate (CHEBI:79053) is a diester (CHEBI:51307) |
| diisobutyl phthalate (CHEBI:79053) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| diisobutyl phthalate |
| Synonyms | Source |
|---|---|
| 1,2-benzenedicarboxylic acid, 1,2-bis(2-methylpropyl) ester | NIST Chemistry WebBook |
| 1,2-benzenedicarboxylic acid bis(2-methylpropyl) ester | ChemIDplus |
| 1,2-benzenedicarboxylic acid di(2-methylpropyl) ester | NIST Chemistry WebBook |
| bis(2-methylpropyl) phthalate | NIST Chemistry WebBook |
| di-2-methylpropyl phthalate | NIST Chemistry WebBook |
| DIBP | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15205 | KEGG COMPOUND |
| Diisobutyl_phthalate | Wikipedia |
| HMDB0013835 | HMDB |
| Citations |
|---|