EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1122A-1x_1-5]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/t1-,2-,3-,4-,6?/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-VANFPWTGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-mannopyranuronic acid (CHEBI:79047) is a D-mannonic acid (CHEBI:33076) |
| Incoming Relation(s) |
| α-D-mannopyranuronic acid (CHEBI:16224) is a D-mannopyranuronic acid (CHEBI:79047) |
| IUPAC Name |
|---|
| D-mannopyranuronic acid |
| Synonym | Source |
|---|---|
| D-Mannuronic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02024 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1427740 | Reaxys |
| CAS:6906-37-2 | KEGG COMPOUND |