EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O3 |
| Net Charge | 0 |
| Average Mass | 118.132 |
| Monoisotopic Mass | 118.06299 |
| SMILES | C[C@@H](O)CCC(=O)O |
| InChI | InChI=1S/C5H10O3/c1-4(6)2-3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m1/s1 |
| InChIKey | FMHKPLXYWVCLME-SCSAIBSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4R)-4-hydroxypentanoic acid (CHEBI:79019) has functional parent valeric acid (CHEBI:17418) |
| (4R)-4-hydroxypentanoic acid (CHEBI:79019) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (4R)-4-hydroxypentanoic acid (CHEBI:79019) is a 4-hydroxy monocarboxylic acid (CHEBI:35970) |
| (4R)-4-hydroxypentanoic acid (CHEBI:79019) is a short-chain fatty acid (CHEBI:26666) |
| Incoming Relation(s) |
| ascr#9 (CHEBI:79018) has functional parent (4R)-4-hydroxypentanoic acid (CHEBI:79019) |
| icas#9 (CHEBI:79028) has functional parent (4R)-4-hydroxypentanoic acid (CHEBI:79019) |
| IUPAC Name |
|---|
| (4R)-4-hydroxypentanoic acid |
| Synonym | Source |
|---|---|
| (4R)-4-hydroxyvaleric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6642342 | Reaxys |