EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O6 |
| Net Charge | 0 |
| Average Mass | 248.275 |
| Monoisotopic Mass | 248.12599 |
| SMILES | C[C@H](CCC(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C11H20O6/c1-6(3-4-10(14)15)16-11-9(13)5-8(12)7(2)17-11/h6-9,11-13H,3-5H2,1-2H3,(H,14,15)/t6-,7+,8-,9-,11-/m1/s1 |
| InChIKey | NZMXMOQNHSVRAJ-WNPHYYBUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | |
| Pristionchus pacificus (ncbitaxon:54126) | - | PubMed (23161728) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#9 (CHEBI:79018) has functional parent (4R)-4-hydroxypentanoic acid (CHEBI:79019) |
| ascr#9 (CHEBI:79018) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#9 (CHEBI:79018) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#9 (CHEBI:79018) is a monocarboxylic acid (CHEBI:25384) |
| ascr#9 (CHEBI:79018) is conjugate acid of ascr#9(1−) (CHEBI:139714) |
| Incoming Relation(s) |
| icas#9 (CHEBI:79028) has functional parent ascr#9 (CHEBI:79018) |
| ascr#9(1−) (CHEBI:139714) is conjugate base of ascr#9 (CHEBI:79018) |
| IUPAC Name |
|---|
| (4R)-4-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]pentanoic acid |
| Synonyms | Source |
|---|---|
| 4R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-pentanoic acid | SMID |
| 4R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-valeric acid | ChEBI |
| (4R)-4-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]valeric acid | ChEBI |
| asc-C5 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%239%0D | SMID |
| LMFA13040007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233381 | Reaxys |
| CAS:1186217-42-4 | SMID |
| Citations |
|---|