EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H40O3 |
| Net Charge | 0 |
| Average Mass | 340.548 |
| Monoisotopic Mass | 340.29775 |
| SMILES | C[C@@H](O)CCCCCCCCCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C21H40O3/c1-20(22)18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-21(23)24/h17,19-20,22H,2-16,18H2,1H3,(H,23,24)/b19-17+/t20-/m1/s1 |
| InChIKey | HUTKGPOSEJZYFJ-LFNFIXQYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,20R)-20-hydroxyhenicos-2-enoic acid (CHEBI:79016) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (2E,20R)-20-hydroxyhenicos-2-enoic acid (CHEBI:79016) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E,20R)-20-hydroxyhenicos-2-enoic acid (CHEBI:79016) is a long-chain fatty acid (CHEBI:15904) |
| (2E,20R)-20-hydroxyhenicos-2-enoic acid (CHEBI:79016) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| ascr#37 (CHEBI:78975) has functional parent (2E,20R)-20-hydroxyhenicos-2-enoic acid (CHEBI:79016) |
| IUPAC Name |
|---|
| (2E,20R)-20-hydroxyhenicos-2-enoic acid |