EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | C[C@@H](O)CCCCCCCCCCC/C=C/C(=O)O |
| InChI | InChI=1S/C16H30O3/c1-15(17)13-11-9-7-5-3-2-4-6-8-10-12-14-16(18)19/h12,14-15,17H,2-11,13H2,1H3,(H,18,19)/b14-12+/t15-/m1/s1 |
| InChIKey | UCYKVNRGXFJHHE-OKFGHLOFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,15R)-15-hydroxyhexadec-2-enoic acid (CHEBI:78997) has functional parent (E)-hexadec-2-enoic acid (CHEBI:37252) |
| (2E,15R)-15-hydroxyhexadec-2-enoic acid (CHEBI:78997) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| (2E,15R)-15-hydroxyhexadec-2-enoic acid (CHEBI:78997) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| (2E,15R)-15-hydroxyhexadec-2-enoic acid (CHEBI:78997) is a long-chain fatty acid (CHEBI:15904) |
| (2E,15R)-15-hydroxyhexadec-2-enoic acid (CHEBI:78997) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| Incoming Relation(s) |
| ascr#27 (CHEBI:78965) has functional parent (2E,15R)-15-hydroxyhexadec-2-enoic acid (CHEBI:78997) |
| IUPAC Name |
|---|
| (2E,15R)-15-hydroxyhexadec-2-enoic acid |