EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H42O6 |
| Net Charge | 0 |
| Average Mass | 414.583 |
| Monoisotopic Mass | 414.29814 |
| SMILES | C[C@H](CCCCCCCCCCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H42O6/c1-18(28-23-21(25)17-20(24)19(2)29-23)15-13-11-9-7-5-3-4-6-8-10-12-14-16-22(26)27/h14,16,18-21,23-25H,3-13,15,17H2,1-2H3,(H,26,27)/b16-14+/t18-,19+,20-,21-,23-/m1/s1 |
| InChIKey | XUIDIXMFLJXJDI-XUAZKPKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Found in dhs-28(hj8), acox-1(ok2257), and maoc-1(hj13) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#29 (CHEBI:78967) has functional parent (2E,16R)-16-hydroxyheptadec-2-enoic acid (CHEBI:78999) |
| ascr#29 (CHEBI:78967) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#29 (CHEBI:78967) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#29 (CHEBI:78967) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#29 (CHEBI:78967) is conjugate acid of ascr#29(1-) (CHEBI:139674) |
| Incoming Relation(s) |
| ascr#29(1-) (CHEBI:139674) is conjugate base of ascr#29 (CHEBI:78967) |
| IUPAC Name |
|---|
| (2E,16R)-16-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]heptadec-2-enoic acid |
| Synonym | Source |
|---|---|
| 16R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2EEheptadecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2329%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233452 | Reaxys |
| CAS:1355681-73-0 | SMID |
| Citations |
|---|