EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38O6 |
| Net Charge | 0 |
| Average Mass | 386.529 |
| Monoisotopic Mass | 386.26684 |
| SMILES | C[C@H](CCCCCCCCCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C21H38O6/c1-16(26-21-19(23)15-18(22)17(2)27-21)13-11-9-7-5-3-4-6-8-10-12-14-20(24)25/h12,14,16-19,21-23H,3-11,13,15H2,1-2H3,(H,24,25)/b14-12+/t16-,17+,18-,19-,21-/m1/s1 |
| InChIKey | MTVUVHUAEUQKIN-YWWXTUTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Detected in daf-22(ok693) and dhs-28(hj8) mutant worms and a major ascaroside in maoc-1(hj13) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#25 (CHEBI:78963) has functional parent (2E,14R)-14-hydroxypentadec-2-enoic acid (CHEBI:78991) |
| ascr#25 (CHEBI:78963) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#25 (CHEBI:78963) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#25 (CHEBI:78963) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#25 (CHEBI:78963) is conjugate acid of ascr#25(1-) (CHEBI:139662) |
| Incoming Relation(s) |
| ascr#25(1-) (CHEBI:139662) is conjugate base of ascr#25 (CHEBI:78963) |
| IUPAC Name |
|---|
| (2E,14R)-14-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]pentadec-2-enoic acid |
| Synonym | Source |
|---|---|
| 14R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-pentadecenoic acid | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%2325%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233430 | Reaxys |
| CAS:1355681-15-0 | SMID |
| Citations |
|---|