EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28N6O14S4 |
| Net Charge | 0 |
| Average Mass | 872.894 |
| Monoisotopic Mass | 872.05463 |
| SMILES | Cc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)cc(N)c4c3O)c(C)c2)ccc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(N)c2c1O |
| InChI | InChI=1S/C34H28N6O14S4/c1-15-7-17(3-5-25(15)37-39-31-27(57(49,50)51)11-19-9-21(55(43,44)45)13-23(35)29(19)33(31)41)18-4-6-26(16(2)8-18)38-40-32-28(58(52,53)54)12-20-10-22(56(46,47)48)14-24(36)30(20)34(32)42/h3-14,41-42H,35-36H2,1-2H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54)/b39-37+,40-38+ |
| InChIKey | ZBNARPCCDMHDDV-HVMBLDELSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trypan blue sulfonic acid (CHEBI:78900) has role dye (CHEBI:37958) |
| trypan blue sulfonic acid (CHEBI:78900) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| trypan blue sulfonic acid (CHEBI:78900) is a azobenzenes (CHEBI:22682) |
| trypan blue sulfonic acid (CHEBI:78900) is a naphthols (CHEBI:25392) |
| trypan blue sulfonic acid (CHEBI:78900) is conjugate acid of trypan blue(4−) (CHEBI:78899) |
| Incoming Relation(s) |
| trypan blue(4−) (CHEBI:78899) is conjugate base of trypan blue sulfonic acid (CHEBI:78900) |
| IUPAC Name |
|---|
| 3,3'-[(3,3'-dimethylbiphenyl-4,4'-diyl)didiazene-2,1-diyl]bis(5-amino-4-hydroxynaphthalene-2,7-disulfonic acid) |
| Synonyms | Source |
|---|---|
| Trypan blue free acid | ChemIDplus |
| trypan blue acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Trypan_blue | Wikipedia |
| 4608 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| CAS:2538-83-2 | ChemIDplus |