EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24O6 |
| Net Charge | 0 |
| Average Mass | 288.340 |
| Monoisotopic Mass | 288.15729 |
| SMILES | C[C@H](CCC/C=C/C(=O)O)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C14H24O6/c1-9(6-4-3-5-7-13(17)18)19-14-12(16)8-11(15)10(2)20-14/h5,7,9-12,14-16H,3-4,6,8H2,1-2H3,(H,17,18)/b7-5+/t9-,10+,11-,12-,14-/m1/s1 |
| InChIKey | OZXQOEFFYWNZJI-UYWLPYIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (22239548) | Absent in daf-22(ok693) mutant worms. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#13 (CHEBI:78851) has functional parent (2E,7R)-7-hydroxyoct-2-enoic acid (CHEBI:78850) |
| ascr#13 (CHEBI:78851) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#13 (CHEBI:78851) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| ascr#13 (CHEBI:78851) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| ascr#13 (CHEBI:78851) is conjugate acid of ascr#13(1-) (CHEBI:139624) |
| Incoming Relation(s) |
| ascr#13(1-) (CHEBI:139624) is conjugate base of ascr#13 (CHEBI:78851) |
| IUPAC Name |
|---|
| (2E,7R)-7-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]oct-2-enoic acid |
| Synonyms | Source |
|---|---|
| 7R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2E-octenoic acid | SMID |
| asc-ΔC8 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%2313%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233389 | Reaxys |
| CAS:1355681-45-6 | SMID |
| Citations |
|---|