EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O6 |
| Net Charge | 0 |
| Average Mass | 220.221 |
| Monoisotopic Mass | 220.09469 |
| SMILES | C[C@@H]1O[C@@H](OCCC(=O)O)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C9H16O6/c1-5-6(10)4-7(11)9(15-5)14-3-2-8(12)13/h5-7,9-11H,2-4H2,1H3,(H,12,13)/t5-,6+,7+,9+/m0/s1 |
| InChIKey | RYYMJVGKZLQYPG-YYWONIAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (18791072) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#5 (CHEBI:78829) has functional parent 3-hydroxypropionic acid (CHEBI:33404) |
| ascr#5 (CHEBI:78829) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#5 (CHEBI:78829) has role pheromone (CHEBI:26013) |
| ascr#5 (CHEBI:78829) is a monocarboxylic acid (CHEBI:25384) |
| ascr#5 (CHEBI:78829) is a ω-hydroxy fatty acid ascaroside (CHEBI:79204) |
| ascr#5 (CHEBI:78829) is conjugate acid of ascr#5(1-) (CHEBI:139707) |
| Incoming Relation(s) |
| ascr#5(1-) (CHEBI:139707) is conjugate base of ascr#5 (CHEBI:78829) |
| IUPAC Name |
|---|
| 3-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]propanoic acid |
| Synonyms | Source |
|---|---|
| (−)-3-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-propanoic acid | SMID |
| 3-hydroxypropanoic acid 3-O-α-ascarylopyranoside | ChEBI |
| ascaroside C3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| ascr%235%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22233379 | Reaxys |
| CAS:1086696-26-5 | SMID |
| Citations |
|---|