EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O3 |
| Net Charge | 0 |
| Average Mass | 90.078 |
| Monoisotopic Mass | 90.03169 |
| SMILES | O=C(O)CCO |
| InChI | InChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6) |
| InChIKey | ALRHLSYJTWAHJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxypropionic acid (CHEBI:33404) has functional parent propionic acid (CHEBI:30768) |
| 3-hydroxypropionic acid (CHEBI:33404) has role Escherichia coli metabolite (CHEBI:76971) |
| 3-hydroxypropionic acid (CHEBI:33404) has role human metabolite (CHEBI:77746) |
| 3-hydroxypropionic acid (CHEBI:33404) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 3-hydroxypropionic acid (CHEBI:33404) is a ω-hydroxy-short-chain fatty acid (CHEBI:194306) |
| 3-hydroxypropionic acid (CHEBI:33404) is conjugate acid of 3-hydroxypropionate (CHEBI:16510) |
| Incoming Relation(s) |
| 3-(3-hydroxyphenyl)-3-hydroxypropanoic acid (CHEBI:86369) has functional parent 3-hydroxypropionic acid (CHEBI:33404) |
| 3-hydroxypropanoyl-CoA (CHEBI:27762) has functional parent 3-hydroxypropionic acid (CHEBI:33404) |
| ascr#5 (CHEBI:78829) has functional parent 3-hydroxypropionic acid (CHEBI:33404) |
| β-propiolactone (CHEBI:49073) has functional parent 3-hydroxypropionic acid (CHEBI:33404) |
| 3-hydroxypropionate (CHEBI:16510) is conjugate base of 3-hydroxypropionic acid (CHEBI:33404) |
| IUPAC Name |
|---|
| 3-hydroxypropanoic acid |
| Synonyms | Source |
|---|---|
| 3-Hydroxypropanoic acid | KEGG COMPOUND |
| 3-HYDROXY-PROPANOIC ACID | PDBeChem |
| 3-Hydroxypropionic acid | KEGG COMPOUND |
| Hydracrylic acid | KEGG COMPOUND |
| β-hydroxypropionic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3OH | PDBeChem |
| C01013 | KEGG COMPOUND |
| DB03688 | DrugBank |
| HMDB0000700 | HMDB |
| LMFA01050003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Gmelin:26307 | Gmelin |
| Reaxys:773806 | Reaxys |
| CAS:503-66-2 | ChemIDplus |
| CAS:503-66-2 | KEGG COMPOUND |
| Citations |
|---|