EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O10 |
| Net Charge | 0 |
| Average Mass | 408.444 |
| Monoisotopic Mass | 408.19955 |
| SMILES | CC(=O)CC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H32O10/c1-8(20)4-5-9(2)25-17-12(6-11(21)10(3)26-17)27-18-16(24)15(23)14(22)13(7-19)28-18/h9-19,21-24H,4-7H2,1-3H3/t9-,10+,11-,12-,13-,14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | HFJWZOCWIUZTNY-WLJKUCSMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (18650807) |
| Roles Classification |
|---|
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#4 (CHEBI:78828) has functional parent ascr#2 (CHEBI:78812) |
| ascr#4 (CHEBI:78828) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#4 (CHEBI:78828) has role pheromone (CHEBI:26013) |
| ascr#4 (CHEBI:78828) is a glycosyl glycoside derivative (CHEBI:63356) |
| ascr#4 (CHEBI:78828) is a hydroxy ketone ascaroside (CHEBI:79201) |
| ascr#4 (CHEBI:78828) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| (2R)-5-oxohexan-2-yl 3,6-dideoxy-2-O-β-D-glucopyranosyl-α-L-arabino-hexopyranoside |
| Synonym | Source |
|---|---|
| (−)-5R-(3'-O-[β-D-glucosyl]-3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2-hexanone | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%234 | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23084288 | Reaxys |
| CAS:1255514-32-9 | SMID |
| Citations |
|---|