EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O5 |
| Net Charge | 0 |
| Average Mass | 246.303 |
| Monoisotopic Mass | 246.14672 |
| SMILES | CC(=O)CC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C12H22O5/c1-7(13)4-5-8(2)16-12-11(15)6-10(14)9(3)17-12/h8-12,14-15H,4-6H2,1-3H3/t8-,9+,10-,11-,12-/m1/s1 |
| InChIKey | KDIFLHQRDPSWHT-IYKVGLELSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (17558398) |
| Roles Classification |
|---|
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascr#2 (CHEBI:78812) has functional parent (5R)-5-hydroxyhexan-2-one (CHEBI:78817) |
| ascr#2 (CHEBI:78812) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| ascr#2 (CHEBI:78812) has role pheromone (CHEBI:26013) |
| ascr#2 (CHEBI:78812) is a hydroxy ketone ascaroside (CHEBI:79201) |
| ascr#2 (CHEBI:78812) is a methyl ketone (CHEBI:51867) |
| Incoming Relation(s) |
| ascr#4 (CHEBI:78828) has functional parent ascr#2 (CHEBI:78812) |
| IUPAC Name |
|---|
| (2R)-5-oxohexan-2-yl 3,6-dideoxy-α-L-arabino-hexopyranoside |
| Synonyms | Source |
|---|---|
| (−)-5R-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2-hexanone | SMID |
| ascaroside C6 | ChEBI |
| daumone-2 | SMID |
| Manual Xrefs | Databases |
|---|---|
| ascr%232%0D | SMID |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19924214 | Reaxys |
| CAS:946524-24-9 | SMID |
| Citations |
|---|