EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H37O2 |
| Net Charge | -1 |
| Average Mass | 297.503 |
| Monoisotopic Mass | 297.27990 |
| SMILES | CCCCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21)/p-1 |
| InChIKey | ISYWECDDZWTKFF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonadecanoate (CHEBI:78796) has role fungal metabolite (CHEBI:76946) |
| nonadecanoate (CHEBI:78796) is a fatty acid anion 19:0 (CHEBI:78892) |
| nonadecanoate (CHEBI:78796) is a straight-chain saturated fatty acid anion (CHEBI:58954) |
| nonadecanoate (CHEBI:78796) is conjugate base of nonadecanoic acid (CHEBI:39246) |
| Incoming Relation(s) |
| 1-nonadecanoyl-2-linoleoyl-sn-glycero-3-phosphocholine (CHEBI:172374) has functional parent nonadecanoate (CHEBI:78796) |
| 1-nonadecanoyl-2-oleoyl-sn-glycero-3-phosphocholine (CHEBI:172373) has functional parent nonadecanoate (CHEBI:78796) |
| nonadecanoic acid (CHEBI:39246) is conjugate acid of nonadecanoate (CHEBI:78796) |
| UniProt Name | Source |
|---|---|
| nonadecanoate | UniProt |