EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:39246 - nonadecanoic acid
| Formula | C19H38O2 |
| Net Charge | 0 |
| Average Mass | 298.511 |
| Monoisotopic Mass | 298.28718 |
| SMILES | CCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h2-18H2,1H3,(H,20,21) |
| InChIKey | ISYWECDDZWTKFF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | spore (BTO:0001171) | PubMed (18827358) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nonadecanoic acid (CHEBI:39246) has role fungal metabolite (CHEBI:76946) |
| nonadecanoic acid (CHEBI:39246) is a long-chain fatty acid (CHEBI:15904) |
| nonadecanoic acid (CHEBI:39246) is a straight-chain saturated fatty acid (CHEBI:39418) |
| nonadecanoic acid (CHEBI:39246) is conjugate acid of nonadecanoate (CHEBI:78796) |
| Incoming Relation(s) |
| (18R)-18-hydroxynonadecanoic acid (CHEBI:79011) has functional parent nonadecanoic acid (CHEBI:39246) |
| N-nonadecanoylsphinganine-1-phosphocholine (CHEBI:90492) has functional parent nonadecanoic acid (CHEBI:39246) |
| N-nonadecanoylsphingosine-1-phosphocholine (CHEBI:84485) has functional parent nonadecanoic acid (CHEBI:39246) |
| O-nonadecanoylcarnitine (CHEBI:137651) has functional parent nonadecanoic acid (CHEBI:39246) |
| 1-nonadecanoyl-sn-glycero-3-phosphocholine (CHEBI:131989) has functional parent nonadecanoic acid (CHEBI:39246) |
| 18-methylnonadecanoic acid (CHEBI:84899) has functional parent nonadecanoic acid (CHEBI:39246) |
| 19-hydroxynonadecanoic acid (CHEBI:79179) has functional parent nonadecanoic acid (CHEBI:39246) |
| 2-hydroxynonadecanoic acid (CHEBI:84855) has functional parent nonadecanoic acid (CHEBI:39246) |
| cholesteryl nonadecanoate (CHEBI:133745) has functional parent nonadecanoic acid (CHEBI:39246) |
| methyl nonadecanoate (CHEBI:87758) has functional parent nonadecanoic acid (CHEBI:39246) |
| nonadecanoyl-CoA (CHEBI:75332) has functional parent nonadecanoic acid (CHEBI:39246) |
| nonadecanoate (CHEBI:78796) is conjugate base of nonadecanoic acid (CHEBI:39246) |
| IUPAC Name |
|---|
| nonadecanoic acid |
| Synonyms | Source |
|---|---|
| 19:00 | ChEBI |
| C19:0 | ChEBI |
| n-nonadecanoic acid | NIST Chemistry WebBook |
| n-Nonadecanoic acid | ChemIDplus |
| nonadecylic acid | ChEBI |
| Nonadecylic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16535 | KEGG COMPOUND |
| HMDB0000772 | HMDB |
| LMFA01010019 | LIPID MAPS |
| Nonadecylic_acid | Wikipedia |
| Citations |
|---|