EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NS2 |
| Net Charge | 0 |
| Average Mass | 147.268 |
| Monoisotopic Mass | 147.01764 |
| SMILES | S=C(S)N1CCCC1 |
| InChI | InChI=1S/C5H9NS2/c7-5(8)6-3-1-2-4-6/h1-4H2,(H,7,8) |
| InChIKey | VSWDORGPIHIGNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticonvulsant A drug used to prevent seizures or reduce their severity. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role anticonvulsant (CHEBI:35623) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role antineoplastic agent (CHEBI:35610) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role geroprotector (CHEBI:176497) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role neuroprotective agent (CHEBI:63726) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role NF-κB inhibitor (CHEBI:73240) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role radical scavenger (CHEBI:48578) |
| pyrrolidine dithiocarbamate (CHEBI:78782) is a dithiocarbamic acids (CHEBI:78787) |
| pyrrolidine dithiocarbamate (CHEBI:78782) is a pyrrolidines (CHEBI:38260) |
| IUPAC Name |
|---|
| pyrrolidine-1-carbodithioic acid |
| Synonyms | Source |
|---|---|
| 1-Pyrrolidinecarbodithioic acid | ChemIDplus |
| Pyrrolidine dithiocarbamic acid | ChemIDplus |
| Pyrrolidine-N-carbodithioic acid | ChemIDplus |
| Tetramethylenedithiocarbamic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 58828 | ChemSpider |
| HMDB0256998 | HMDB |
| LSM-3818 | LINCS |
| Pyrrolidine_dithiocarbamate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:110285 | Reaxys |
| CAS:25769-03-3 | ChemIDplus |
| Citations |
|---|