EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NS2 |
| Net Charge | 0 |
| Average Mass | 147.268 |
| Monoisotopic Mass | 147.01764 |
| SMILES | S=C(S)N1CCCC1 |
| InChI | InChI=1S/C5H9NS2/c7-5(8)6-3-1-2-4-6/h1-4H2,(H,7,8) |
| InChIKey | VSWDORGPIHIGNW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role anticonvulsant (CHEBI:35623) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role antineoplastic agent (CHEBI:35610) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role geroprotector (CHEBI:176497) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role neuroprotective agent (CHEBI:63726) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role NF-κB inhibitor (CHEBI:73240) |
| pyrrolidine dithiocarbamate (CHEBI:78782) has role radical scavenger (CHEBI:48578) |
| pyrrolidine dithiocarbamate (CHEBI:78782) is a dithiocarbamic acids (CHEBI:78787) |
| pyrrolidine dithiocarbamate (CHEBI:78782) is a pyrrolidines (CHEBI:38260) |
| IUPAC Name |
|---|
| pyrrolidine-1-carbodithioic acid |
| Synonyms | Source |
|---|---|
| 1-Pyrrolidinecarbodithioic acid | ChemIDplus |
| Pyrrolidine dithiocarbamic acid | ChemIDplus |
| Pyrrolidine-N-carbodithioic acid | ChemIDplus |
| Tetramethylenedithiocarbamic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 58828 | ChemSpider |
| HMDB0256998 | HMDB |
| LSM-3818 | LINCS |
| Pyrrolidine_dithiocarbamate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:110285 | Reaxys |
| CAS:25769-03-3 | ChemIDplus |
| Citations |
|---|